C30H39N2O6+ — CID 176680619
[4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]-4-oxobutyl]-dimethylazanium (PubChem CID 176680619) has the molecular formula C30H39N2O6+ and a molecular weight of 523.65 g/mol. Its IUPAC name is [4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]-4-oxobutyl]-dimethylazanium.
| Compound Name | [4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]-4-oxobutyl]-dimethylazanium |
|---|---|
| PubChem CID | 176680619 |
| Molecular Formula | C30H39N2O6+ |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | [4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]-4-oxobutyl]-dimethylazanium |
| SMILES | COc1ccc(/C=C2\CC(NC(=O)CCC[NH+](C)C)C/C(=C\c3ccc(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C30H38N2O6/c1-32(2)13-7-8-29(33)31-24-18-22(14-20-9-11-25(35-3)27(16-20)37-5)30(34)23(19-24)15-21-10-12-26(36-4)28(17-21)38-6/h9-12,14-17,24H,7-8,13,18-19H2,1-6H3,(H,31,33)/p+1/b22-14+,23-15+ |
| InChIKey | IGAUXOOKCBAEIU-HOFJZWJUSA-O |
| XLogP | 2.96 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|