C33H33F3N2O9 — CID 176680649
N-[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]-2-pyridin-1-ium-4-yloxyacetamide;2,2,2-trifluoroacetate (PubChem CID 176680649) has the molecular formula C33H33F3N2O9 and a molecular weight of 658.63 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]-2-pyridin-1-ium-4-yloxyacetamide;2,2,2-trifluoroacetate.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]-2-pyridin-1-ium-4-yloxyacetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 176680649 |
| Molecular Formula | C33H33F3N2O9 |
| Molecular Weight | 658.63 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]-2-pyridin-1-ium-4-yloxyacetamide;2,2,2-trifluoroacetate |
| SMILES | COc1ccc(/C=C2\CC(NC(=O)COc3cc[nH+]cc3)C/C(=C\c3ccc(OC)c(OC)c3)C2=O)cc1OC.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C31H32N2O7.C2HF3O2/c1-36-26-7-5-20(15-28(26)38-3)13-22-17-24(33-30(34)19-40-25-9-11-32-12-10-25)18-23(31(22)35)14-21-6-8-27(37-2)29(16-21)39-4;3-2(4,5)1(6)7/h5-16,24H,17-19H2,1-4H3,(H,33,34);(H,6,7)/b22-13+,23-14+; |
| InChIKey | HRKBCEFTHGAQGC-GIXCQGAQSA-N |
| XLogP | 3.23 |
| TPSA | 146.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|