C32H34N2O7S — CID 176680663
2-[4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]sulfanylphenoxy]acetamide (PubChem CID 176680663) has the molecular formula C32H34N2O7S and a molecular weight of 590.70 g/mol. Its IUPAC name is 2-[4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]sulfanylphenoxy]acetamide.
| Compound Name | 2-[4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]sulfanylphenoxy]acetamide |
|---|---|
| PubChem CID | 176680663 |
| Molecular Formula | C32H34N2O7S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-[4-[[(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]-4-oxocyclohexyl]amino]sulfanylphenoxy]acetamide |
| SMILES | COc1ccc(/C=C2\CC(NSc3ccc(OCC(N)=O)cc3)C/C(=C\c3ccc(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C32H34N2O7S/c1-37-27-11-5-20(15-29(27)39-3)13-22-17-24(34-42-26-9-7-25(8-10-26)41-19-31(33)35)18-23(32(22)36)14-21-6-12-28(38-2)30(16-21)40-4/h5-16,24,34H,17-19H2,1-4H3,(H2,33,35)/b22-13+,23-14+ |
| InChIKey | TZFFDRQUTFUIMB-MSKUYSOUSA-N |
| XLogP | 5.08 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|