C29H29NO5 — CID 155654057
(3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-[[4-(hydroxymethyl)-3-methoxyphenyl]methylidene]-1-phenylpiperidin-4-one (PubChem CID 155654057) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is (3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-[[4-(hydroxymethyl)-3-methoxyphenyl]methylidene]-1-phenylpiperidin-4-one.
| Compound Name | (3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-[[4-(hydroxymethyl)-3-methoxyphenyl]methylidene]-1-phenylpiperidin-4-one |
|---|---|
| PubChem CID | 155654057 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-[[4-(hydroxymethyl)-3-methoxyphenyl]methylidene]-1-phenylpiperidin-4-one |
| SMILES | COc1cc(/C=C2\CN(c3ccccc3)C/C(=C\c3ccc(OC)c(OC)c3)C2=O)ccc1CO |
| InChI | InChI=1S/C29H29NO5/c1-33-26-12-10-21(16-28(26)35-3)14-24-18-30(25-7-5-4-6-8-25)17-23(29(24)32)13-20-9-11-22(19-31)27(15-20)34-2/h4-16,31H,17-19H2,1-3H3/b23-13+,24-14+ |
| InChIKey | OBGDPSASBNTCLT-RNIAWFEPSA-N |
| XLogP | 4.76 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|