C19H18O — CID 92525608
(6Z)-6-[(3-methylphenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 92525608) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is (6Z)-6-[(3-methylphenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one.
| Compound Name | (6Z)-6-[(3-methylphenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 92525608 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (6Z)-6-[(3-methylphenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | Cc1cccc(/C=C2/CCCc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H18O/c1-14-6-4-7-15(12-14)13-17-10-5-9-16-8-2-3-11-18(16)19(17)20/h2-4,6-8,11-13H,5,9-10H2,1H3/b17-13- |
| InChIKey | XZPQTNCICNGJBL-LGMDPLHJSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|