C18H15FO — CID 5396603
(6E)-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 5396603) has the molecular formula C18H15FO and a molecular weight of 266.32 g/mol. Its IUPAC name is (6E)-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one.
| Compound Name | (6E)-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 5396603 |
| Molecular Formula | C18H15FO |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (6E)-6-[(4-fluorophenyl)methylidene]-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | O=C1/C(=C/c2ccc(F)cc2)CCCc2ccccc21 |
| InChI | InChI=1S/C18H15FO/c19-16-10-8-13(9-11-16)12-15-6-3-5-14-4-1-2-7-17(14)18(15)20/h1-2,4,7-12H,3,5-6H2/b15-12+ |
| InChIKey | ICCNQCYBMACSJF-NTCAYCPXSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|