C20H18O — CID 1240877
(6E)-2,6-dibenzylidenecyclohexan-1-one (PubChem CID 1240877) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (6E)-2,6-dibenzylidenecyclohexan-1-one.
| Compound Name | (6E)-2,6-dibenzylidenecyclohexan-1-one |
|---|---|
| PubChem CID | 1240877 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (6E)-2,6-dibenzylidenecyclohexan-1-one |
| SMILES | O=C1C(=Cc2ccccc2)CCC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C20H18O/c21-20-18(14-16-8-3-1-4-9-16)12-7-13-19(20)15-17-10-5-2-6-11-17/h1-6,8-11,14-15H,7,12-13H2/b18-14+,19-15? |
| InChIKey | CTKKGXDAWIAYSA-KRKQTQCISA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|