C27H24O2 — CID 2313566
(2E,6Z)-2-[(4-methoxyphenyl)methylidene]-6-[(4-phenylphenyl)methylidene]cyclohexan-1-one (PubChem CID 2313566) has the molecular formula C27H24O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2E,6Z)-2-[(4-methoxyphenyl)methylidene]-6-[(4-phenylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6Z)-2-[(4-methoxyphenyl)methylidene]-6-[(4-phenylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 2313566 |
| Molecular Formula | C27H24O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2E,6Z)-2-[(4-methoxyphenyl)methylidene]-6-[(4-phenylphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1ccc(/C=C2\CCC/C(=C/c3ccc(-c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H24O2/c1-29-26-16-12-21(13-17-26)19-25-9-5-8-24(27(25)28)18-20-10-14-23(15-11-20)22-6-3-2-4-7-22/h2-4,6-7,10-19H,5,8-9H2,1H3/b24-18-,25-19+ |
| InChIKey | HVKCBNUPZFNZJJ-ZFQRDYFNSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|