C22H23NO — CID 2313555
(2E,6E)-2-benzylidene-6-[[4-(dimethylamino)phenyl]methylidene]cyclohexan-1-one (PubChem CID 2313555) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (2E,6E)-2-benzylidene-6-[[4-(dimethylamino)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-benzylidene-6-[[4-(dimethylamino)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 2313555 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2E,6E)-2-benzylidene-6-[[4-(dimethylamino)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CN(C)c1ccc(/C=C2\CCC/C(=C\c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23NO/c1-23(2)21-13-11-18(12-14-21)16-20-10-6-9-19(22(20)24)15-17-7-4-3-5-8-17/h3-5,7-8,11-16H,6,9-10H2,1-2H3/b19-15+,20-16+ |
| InChIKey | CFJKPSPNYKZMNU-MXWIWYRXSA-N |
| XLogP | 4.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|