C21H21N3 — CID 58659824
4-[(E)-3,4-dihydro-2H-phenazin-1-ylidenemethyl]-N,N-dimethylaniline (PubChem CID 58659824) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[(E)-3,4-dihydro-2H-phenazin-1-ylidenemethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-3,4-dihydro-2H-phenazin-1-ylidenemethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58659824 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-[(E)-3,4-dihydro-2H-phenazin-1-ylidenemethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C2\CCCc3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C21H21N3/c1-24(2)17-12-10-15(11-13-17)14-16-6-5-9-20-21(16)23-19-8-4-3-7-18(19)22-20/h3-4,7-8,10-14H,5-6,9H2,1-2H3/b16-14+ |
| InChIKey | OQSNSYXABVYHMD-JQIJEIRASA-N |
| XLogP | 4.57 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|