C21H24FNO — CID 174752961
2-[(4-fluorophenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline (PubChem CID 174752961) has the molecular formula C21H24FNO and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline.
| Compound Name | 2-[(4-fluorophenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 174752961 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[(4-fluorophenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)cc1.O=C1CCCC1=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FO.C9H13N/c13-11-6-4-9(5-7-11)8-10-2-1-3-12(10)14;1-8-4-6-9(7-5-8)10(2)3/h4-8H,1-3H2;4-7H,1-3H3 |
| InChIKey | BOLMQRMUPNUNIV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|