C22H27NO2 — CID 174753342
2-[(3-methoxyphenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline (PubChem CID 174753342) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline.
| Compound Name | 2-[(3-methoxyphenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 174753342 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylidene]cyclopentan-1-one;N,N,4-trimethylaniline |
| SMILES | COc1cccc(C=C2CCCC2=O)c1.Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H14O2.C9H13N/c1-15-12-6-2-4-10(9-12)8-11-5-3-7-13(11)14;1-8-4-6-9(7-5-8)10(2)3/h2,4,6,8-9H,3,5,7H2,1H3;4-7H,1-3H3 |
| InChIKey | KAHFEKRNSXAKMA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|