C14H14O2 — CID 67064982
2-[(3-methoxyphenyl)methylidene]-5-methylidenecyclopentan-1-one (PubChem CID 67064982) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylidene]-5-methylidenecyclopentan-1-one.
| Compound Name | 2-[(3-methoxyphenyl)methylidene]-5-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 67064982 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylidene]-5-methylidenecyclopentan-1-one |
| SMILES | C=C1CCC(=Cc2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C14H14O2/c1-10-6-7-12(14(10)15)8-11-4-3-5-13(9-11)16-2/h3-5,8-9H,1,6-7H2,2H3 |
| InChIKey | GQXHLDNUDJPGOB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|