C28H28NO3+ — CID 2388260
(3E,5E)-1-benzyl-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-1-ium-4-one (PubChem CID 2388260) has the molecular formula C28H28NO3+ and a molecular weight of 426.54 g/mol. Its IUPAC name is (3E,5E)-1-benzyl-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-1-ium-4-one.
| Compound Name | (3E,5E)-1-benzyl-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 2388260 |
| Molecular Formula | C28H28NO3+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3E,5E)-1-benzyl-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-1-ium-4-one |
| SMILES | COc1cccc(/C=C2\C[NH+](Cc3ccccc3)C/C(=C\c3cccc(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C28H27NO3/c1-31-26-12-6-10-22(16-26)14-24-19-29(18-21-8-4-3-5-9-21)20-25(28(24)30)15-23-11-7-13-27(17-23)32-2/h3-17H,18-20H2,1-2H3/p+1/b24-14+,25-15+ |
| InChIKey | AIQWHIYOLDHKFR-KOJZRSEWSA-O |
| XLogP | 3.84 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|