C21H22NO3+ — CID 8858585
(3Z,5E)-1-ethyl-3,5-bis[(3-hydroxyphenyl)methylidene]piperidin-1-ium-4-one (PubChem CID 8858585) has the molecular formula C21H22NO3+ and a molecular weight of 336.41 g/mol. Its IUPAC name is (3Z,5E)-1-ethyl-3,5-bis[(3-hydroxyphenyl)methylidene]piperidin-1-ium-4-one.
| Compound Name | (3Z,5E)-1-ethyl-3,5-bis[(3-hydroxyphenyl)methylidene]piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 8858585 |
| Molecular Formula | C21H22NO3+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3Z,5E)-1-ethyl-3,5-bis[(3-hydroxyphenyl)methylidene]piperidin-1-ium-4-one |
| SMILES | CC[NH+]1C/C(=C/c2cccc(O)c2)C(=O)/C(=C/c2cccc(O)c2)C1 |
| InChI | InChI=1S/C21H21NO3/c1-2-22-13-17(9-15-5-3-7-19(23)11-15)21(25)18(14-22)10-16-6-4-8-20(24)12-16/h3-12,23-24H,2,13-14H2,1H3/p+1/b17-9-,18-10+ |
| InChIKey | UXSDJQKTTWLNLR-BUOZRGFLSA-O |
| XLogP | 2.05 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|