C23H26NO3+ — CID 6993742
(3E)-1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-1-ium-4-one (PubChem CID 6993742) has the molecular formula C23H26NO3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is (3E)-1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-1-ium-4-one.
| Compound Name | (3E)-1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 6993742 |
| Molecular Formula | C23H26NO3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3E)-1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-1-ium-4-one |
| SMILES | CC[NH+]1CC(=Cc2ccc(OC)cc2)C(=O)/C(=C/c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C23H25NO3/c1-4-24-15-19(13-17-5-9-21(26-2)10-6-17)23(25)20(16-24)14-18-7-11-22(27-3)12-8-18/h5-14H,4,15-16H2,1-3H3/p+1/b19-13+,20-14? |
| InChIKey | VQUWAROOHKASSD-SHTSLDKLSA-O |
| XLogP | 2.66 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|