C23H26ClNO3 — CID 73243048
1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one;hydrochloride (PubChem CID 73243048) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is 1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one;hydrochloride.
| Compound Name | 1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 73243048 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-ethyl-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one;hydrochloride |
| SMILES | CCN1CC(=Cc2ccc(OC)cc2)C(=O)C(=Cc2ccc(OC)cc2)C1.Cl |
| InChI | InChI=1S/C23H25NO3.ClH/c1-4-24-15-19(13-17-5-9-21(26-2)10-6-17)23(25)20(16-24)14-18-7-11-22(27-3)12-8-18;/h5-14H,4,15-16H2,1-3H3;1H |
| InChIKey | BNCCLTDZHILSJA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|