C25H27NO3 — CID 51129084
(3Z,5E)-1-(cyclopropylmethyl)-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-4-one (PubChem CID 51129084) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (3Z,5E)-1-(cyclopropylmethyl)-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3Z,5E)-1-(cyclopropylmethyl)-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 51129084 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3Z,5E)-1-(cyclopropylmethyl)-3,5-bis[(3-methoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1cccc(/C=C2/CN(CC3CC3)C/C(=C\c3cccc(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C25H27NO3/c1-28-23-7-3-5-19(13-23)11-21-16-26(15-18-9-10-18)17-22(25(21)27)12-20-6-4-8-24(14-20)29-2/h3-8,11-14,18H,9-10,15-17H2,1-2H3/b21-11-,22-12+ |
| InChIKey | JIIWCYKJWSVMRR-ZCJKAFFOSA-N |
| XLogP | 4.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|