C24H25NO3 — CID 98185577
(1R,2E,4E,5R)-2,4-bis[(3-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 98185577) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,2E,4E,5R)-2,4-bis[(3-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2E,4E,5R)-2,4-bis[(3-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 98185577 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (1R,2E,4E,5R)-2,4-bis[(3-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | COc1cccc(/C=C2/C(=O)/C(=C/c3cccc(OC)c3)[C@H]3CC[C@H]2N3C)c1 |
| InChI | InChI=1S/C24H25NO3/c1-25-22-10-11-23(25)21(15-17-7-5-9-19(13-17)28-3)24(26)20(22)14-16-6-4-8-18(12-16)27-2/h4-9,12-15,22-23H,10-11H2,1-3H3/b20-14+,21-15+/t22-,23-/m1/s1 |
| InChIKey | UVAFOFIZKCEFLP-KTTVPDLZSA-N |
| XLogP | 4.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|