C20H18N2O3 — CID 71964007
(11aS)-3-[(3-methoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 71964007) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is (11aS)-3-[(3-methoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | (11aS)-3-[(3-methoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 71964007 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (11aS)-3-[(3-methoxyphenyl)methylidene]-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | COc1cccc(C=C2NC(=O)[C@@H]3Cc4ccccc4CN3C2=O)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-25-16-8-4-5-13(9-16)10-17-20(24)22-12-15-7-3-2-6-14(15)11-18(22)19(23)21-17/h2-10,18H,11-12H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | CTPDHJIBKLKSRK-SFHVURJKSA-N |
| XLogP | 2.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|