C29H27BrN2O6 — CID 177470644
(3E,6R,11aS)-6-(4-bromophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-8,9-dimethoxy-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 177470644) has the molecular formula C29H27BrN2O6 and a molecular weight of 579.45 g/mol. Its IUPAC name is (3E,6R,11aS)-6-(4-bromophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-8,9-dimethoxy-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | (3E,6R,11aS)-6-(4-bromophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-8,9-dimethoxy-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 177470644 |
| Molecular Formula | C29H27BrN2O6 |
| Molecular Weight | 579.45 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | (3E,6R,11aS)-6-(4-bromophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-8,9-dimethoxy-11,11a-dihydro-6H-pyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | COc1ccc(/C=C2/NC(=O)[C@@H]3Cc4cc(OC)c(OC)cc4[C@@H](c4ccc(Br)cc4)N3C2=O)cc1OC |
| InChI | InChI=1S/C29H27BrN2O6/c1-35-23-10-5-16(12-24(23)36-2)11-21-29(34)32-22(28(33)31-21)13-18-14-25(37-3)26(38-4)15-20(18)27(32)17-6-8-19(30)9-7-17/h5-12,14-15,22,27H,13H2,1-4H3,(H,31,33)/b21-11+/t22-,27+/m0/s1 |
| InChIKey | MOVKNIFTYATSOA-OIHSIZGTSA-N |
| XLogP | 4.50 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|