C12H12N2O4 — CID 2189796
(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 2189796) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2189796 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\NC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C12H12N2O4/c1-17-9-4-3-7(6-10(9)18-2)5-8-11(15)14-12(16)13-8/h3-6H,1-2H3,(H2,13,14,15,16)/b8-5- |
| InChIKey | NKQBXYVAZTZVMV-YVMONPNESA-N |
| XLogP | 0.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|