C13H14N2O5 — CID 760516
(5E)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 760516) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is (5E)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 760516 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (5E)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/NC(=O)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H14N2O5/c1-18-9-5-7(6-10(19-2)11(9)20-3)4-8-12(16)15-13(17)14-8/h4-6H,1-3H3,(H2,14,15,16,17)/b8-4+ |
| InChIKey | MIPHJRZSHMVBJB-XBXARRHUSA-N |
| XLogP | 0.89 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|