C13H11IN2O5 — CID 2169359
[4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 2169359) has the molecular formula C13H11IN2O5 and a molecular weight of 402.14 g/mol. Its IUPAC name is [4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 2169359 |
| Molecular Formula | C13H11IN2O5 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | [4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2\NC(=O)NC2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C13H11IN2O5/c1-6(17)21-11-8(14)3-7(5-10(11)20-2)4-9-12(18)16-13(19)15-9/h3-5H,1-2H3,(H2,15,16,18,19)/b9-4- |
| InChIKey | UWNKRXGWVMXTQU-WTKPLQERSA-N |
| XLogP | 1.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|