C11H12IN3O3S — CID 19617673
[4-[(E)-(carbamothioylhydrazinylidene)methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 19617673) has the molecular formula C11H12IN3O3S and a molecular weight of 393.21 g/mol. Its IUPAC name is [4-[(E)-(carbamothioylhydrazinylidene)methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-(carbamothioylhydrazinylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 19617673 |
| Molecular Formula | C11H12IN3O3S |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | [4-[(E)-(carbamothioylhydrazinylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=N/NC(N)=S)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C11H12IN3O3S/c1-6(16)18-10-8(12)3-7(4-9(10)17-2)5-14-15-11(13)19/h3-5H,1-2H3,(H3,13,15,19)/b14-5+ |
| InChIKey | NMZYIODNPNUAOV-LHHJGKSTSA-N |
| XLogP | 1.39 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|