C15H14INO4S2 — CID 1328808
[4-[(2-ethylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 1328808) has the molecular formula C15H14INO4S2 and a molecular weight of 463.32 g/mol. Its IUPAC name is [4-[(2-ethylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[(2-ethylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1328808 |
| Molecular Formula | C15H14INO4S2 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | [4-[(2-ethylsulfanyl-5-oxo-1,3-thiazol-4-ylidene)methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | CCSC1=NC(=Cc2cc(I)c(OC(C)=O)c(OC)c2)C(=O)S1 |
| InChI | InChI=1S/C15H14INO4S2/c1-4-22-15-17-11(14(19)23-15)6-9-5-10(16)13(21-8(2)18)12(7-9)20-3/h5-7H,4H2,1-3H3 |
| InChIKey | RGRRFZOJBOOUEC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|