C17H18ClNO4S2 — CID 2934755
[2-chloro-6-ethoxy-4-[(5-oxo-2-propylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 2934755) has the molecular formula C17H18ClNO4S2 and a molecular weight of 399.92 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(5-oxo-2-propylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-chloro-6-ethoxy-4-[(5-oxo-2-propylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 2934755 |
| Molecular Formula | C17H18ClNO4S2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(5-oxo-2-propylsulfanyl-1,3-thiazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | CCCSC1=NC(=Cc2cc(Cl)c(OC(C)=O)c(OCC)c2)C(=O)S1 |
| InChI | InChI=1S/C17H18ClNO4S2/c1-4-6-24-17-19-13(16(21)25-17)8-11-7-12(18)15(23-10(3)20)14(9-11)22-5-2/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZMVGBSXQEHNULF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|