C28H28Cl2O7 — CID 56692960
[4-[(E)-[(3Z)-3-[(4-acetyloxy-3-chloro-5-ethoxyphenyl)methylidene]-2-oxocyclohexylidene]methyl]-2-chloro-6-ethoxyphenyl] acetate (PubChem CID 56692960) has the molecular formula C28H28Cl2O7 and a molecular weight of 547.43 g/mol. Its IUPAC name is [4-[(E)-[(3Z)-3-[(4-acetyloxy-3-chloro-5-ethoxyphenyl)methylidene]-2-oxocyclohexylidene]methyl]-2-chloro-6-ethoxyphenyl] acetate.
| Compound Name | [4-[(E)-[(3Z)-3-[(4-acetyloxy-3-chloro-5-ethoxyphenyl)methylidene]-2-oxocyclohexylidene]methyl]-2-chloro-6-ethoxyphenyl] acetate |
|---|---|
| PubChem CID | 56692960 |
| Molecular Formula | C28H28Cl2O7 |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | [4-[(E)-[(3Z)-3-[(4-acetyloxy-3-chloro-5-ethoxyphenyl)methylidene]-2-oxocyclohexylidene]methyl]-2-chloro-6-ethoxyphenyl] acetate |
| SMILES | CCOc1cc(/C=C2/CCC/C(=C\c3cc(Cl)c(OC(C)=O)c(OCC)c3)C2=O)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C28H28Cl2O7/c1-5-34-24-14-18(12-22(29)27(24)36-16(3)31)10-20-8-7-9-21(26(20)33)11-19-13-23(30)28(37-17(4)32)25(15-19)35-6-2/h10-15H,5-9H2,1-4H3/b20-10-,21-11+ |
| InChIKey | YABNCXKMLZUVIP-NGHQTVFFSA-N |
| XLogP | 6.86 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|