C22H20ClNO3S2 — CID 2298444
(4Z)-4-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one (PubChem CID 2298444) has the molecular formula C22H20ClNO3S2 and a molecular weight of 445.99 g/mol. Its IUPAC name is (4Z)-4-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one.
| Compound Name | (4Z)-4-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2298444 |
| Molecular Formula | C22H20ClNO3S2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (4Z)-4-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-2-prop-2-enylsulfanyl-1,3-thiazol-5-one |
| SMILES | C=CCSC1=N/C(=C\c2cc(Cl)c(OCc3ccccc3)c(OCC)c2)C(=O)S1 |
| InChI | InChI=1S/C22H20ClNO3S2/c1-3-10-28-22-24-18(21(25)29-22)12-16-11-17(23)20(19(13-16)26-4-2)27-14-15-8-6-5-7-9-15/h3,5-9,11-13H,1,4,10,14H2,2H3/b18-12- |
| InChIKey | WGLPHRSAFXBFEY-PDGQHHTCSA-N |
| XLogP | 6.21 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|