C24H19ClO3S — CID 124650845
(2E)-2-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one (PubChem CID 124650845) has the molecular formula C24H19ClO3S and a molecular weight of 422.93 g/mol. Its IUPAC name is (2E)-2-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one.
| Compound Name | (2E)-2-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 124650845 |
| Molecular Formula | C24H19ClO3S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (2E)-2-[(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one |
| SMILES | CCOc1cc(/C=C2/Sc3ccccc3C2=O)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H19ClO3S/c1-2-27-20-13-17(14-22-23(26)18-10-6-7-11-21(18)29-22)12-19(25)24(20)28-15-16-8-4-3-5-9-16/h3-14H,2,15H2,1H3/b22-14+ |
| InChIKey | FTYZKIAFPGJLHT-HYARGMPZSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|