C19H16O5S — CID 73462839
2-[2-ethoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]acetic acid (PubChem CID 73462839) has the molecular formula C19H16O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 73462839 |
| Molecular Formula | C19H16O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[2-ethoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C=C2Sc3ccccc3C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H16O5S/c1-2-23-15-9-12(7-8-14(15)24-11-18(20)21)10-17-19(22)13-5-3-4-6-16(13)25-17/h3-10H,2,11H2,1H3,(H,20,21) |
| InChIKey | QFUUKQLEPLGKDE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|