C25H21NO4S — CID 126318565
2-[2-methoxy-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126318565) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126318565 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\Sc3ccccc3C2=O)ccc1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H21NO4S/c1-16-6-5-7-18(12-16)26-24(27)15-30-20-11-10-17(13-21(20)29-2)14-23-25(28)19-8-3-4-9-22(19)31-23/h3-14H,15H2,1-2H3,(H,26,27)/b23-14- |
| InChIKey | LMCYSKLITCHMIN-UCQKPKSFSA-N |
| XLogP | 5.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|