C24H20O3S — CID 126342381
(2Z)-2-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one (PubChem CID 126342381) has the molecular formula C24H20O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (2Z)-2-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 126342381 |
| Molecular Formula | C24H20O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2Z)-2-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3C2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H20O3S/c1-16-7-9-17(10-8-16)15-27-20-12-11-18(13-21(20)26-2)14-23-24(25)19-5-3-4-6-22(19)28-23/h3-14H,15H2,1-2H3/b23-14- |
| InChIKey | RDCUKJPPDTVPHT-UCQKPKSFSA-N |
| XLogP | 5.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|