C23H18O5S2 — CID 2882609
[2-methoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2882609) has the molecular formula C23H18O5S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is [2-methoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2882609 |
| Molecular Formula | C23H18O5S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [2-methoxy-4-[(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C=C2Sc3ccccc3C2=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H18O5S2/c1-15-7-10-17(11-8-15)30(25,26)28-19-12-9-16(13-20(19)27-2)14-22-23(24)18-5-3-4-6-21(18)29-22/h3-14H,1-2H3 |
| InChIKey | OERFJZDXUYBERT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|