C17H14O4S — CID 839991
(2Z)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1-benzothiophen-3-one (PubChem CID 839991) has the molecular formula C17H14O4S and a molecular weight of 314.36 g/mol. Its IUPAC name is (2Z)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 839991 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2Z)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1-benzothiophen-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3C2=O)cc(OC)c1O |
| InChI | InChI=1S/C17H14O4S/c1-20-12-7-10(8-13(21-2)17(12)19)9-15-16(18)11-5-3-4-6-14(11)22-15/h3-9,19H,1-2H3/b15-9- |
| InChIKey | QAVXFCTWAOCJHX-DHDCSXOGSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|