C19H16O5S — CID 1026998
[2,6-dimethoxy-4-[(E)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] acetate (PubChem CID 1026998) has the molecular formula C19H16O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(E)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(E)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 1026998 |
| Molecular Formula | C19H16O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [2,6-dimethoxy-4-[(E)-(3-oxo-1-benzothiophen-2-ylidene)methyl]phenyl] acetate |
| SMILES | COc1cc(/C=C2/Sc3ccccc3C2=O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C19H16O5S/c1-11(20)24-19-14(22-2)8-12(9-15(19)23-3)10-17-18(21)13-6-4-5-7-16(13)25-17/h4-10H,1-3H3/b17-10+ |
| InChIKey | SHAJNCLHIWNGOR-LICLKQGHSA-N |
| XLogP | 3.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|