C23H17BrO3S — CID 3562222
2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one (PubChem CID 3562222) has the molecular formula C23H17BrO3S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one.
| Compound Name | 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 3562222 |
| Molecular Formula | C23H17BrO3S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 2-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-benzothiophen-3-one |
| SMILES | COc1cc(C=C2Sc3ccccc3C2=O)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H17BrO3S/c1-26-19-11-16(12-22-23(25)17-9-5-6-10-21(17)28-22)18(24)13-20(19)27-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3 |
| InChIKey | IHSCSODIUGWXHA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|