C23H17Br2NO3 — CID 126125008
(3Z)-3-[[2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]-1H-indol-2-one (PubChem CID 126125008) has the molecular formula C23H17Br2NO3 and a molecular weight of 515.20 g/mol. Its IUPAC name is (3Z)-3-[[2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 126125008 |
| Molecular Formula | C23H17Br2NO3 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | (3Z)-3-[[2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccccc32)c(Br)cc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17Br2NO3/c1-28-21-11-15(10-18-17-4-2-3-5-20(17)26-23(18)27)19(25)12-22(21)29-13-14-6-8-16(24)9-7-14/h2-12H,13H2,1H3,(H,26,27)/b18-10- |
| InChIKey | QKZHFVBOTHRTSM-ZDLGFXPLSA-N |
| XLogP | 6.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|