C24H20O7S2 — CID 30884365
[2-methoxy-4-[(Z)-(1,1,4-trioxothiochromen-3-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 30884365) has the molecular formula C24H20O7S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(1,1,4-trioxothiochromen-3-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(1,1,4-trioxothiochromen-3-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 30884365 |
| Molecular Formula | C24H20O7S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [2-methoxy-4-[(Z)-(1,1,4-trioxothiochromen-3-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C2\CS(=O)(=O)c3ccccc3C2=O)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H20O7S2/c1-16-7-10-19(11-8-16)33(28,29)31-21-12-9-17(14-22(21)30-2)13-18-15-32(26,27)23-6-4-3-5-20(23)24(18)25/h3-14H,15H2,1-2H3/b18-13+ |
| InChIKey | GWCDORKEDFCUSF-QGOAFFKASA-N |
| XLogP | 3.82 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|