C23H23NO4S — CID 126221701
[4-[(2,3-dimethylphenyl)iminomethyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 126221701) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is [4-[(2,3-dimethylphenyl)iminomethyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2,3-dimethylphenyl)iminomethyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126221701 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [4-[(2,3-dimethylphenyl)iminomethyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=N/c2cccc(C)c2C)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-16-8-11-20(12-9-16)29(25,26)28-22-13-10-19(14-23(22)27-4)15-24-21-7-5-6-17(2)18(21)3/h5-15H,1-4H3/b24-15+ |
| InChIKey | AAMIQBSTAJXZOU-BUVRLJJBSA-N |
| XLogP | 5.14 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|