C30H28N2O14S4 — CID 20811104
[(E)-[(2E)-2-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]sulfonyloxyiminoethylidene]amino] 3-methoxy-4-(4-methylphenyl)sulfonyloxybenzenesulfonate (PubChem CID 20811104) has the molecular formula C30H28N2O14S4 and a molecular weight of 768.82 g/mol. Its IUPAC name is [(E)-[(2E)-2-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]sulfonyloxyiminoethylidene]amino] 3-methoxy-4-(4-methylphenyl)sulfonyloxybenzenesulfonate.
| Compound Name | [(E)-[(2E)-2-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]sulfonyloxyiminoethylidene]amino] 3-methoxy-4-(4-methylphenyl)sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 20811104 |
| Molecular Formula | C30H28N2O14S4 |
| Molecular Weight | 768.82 g/mol |
| Exact Mass | 768.04 |
| IUPAC Name | [(E)-[(2E)-2-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]sulfonyloxyiminoethylidene]amino] 3-methoxy-4-(4-methylphenyl)sulfonyloxybenzenesulfonate |
| SMILES | COc1cc(S(=O)(=O)O/N=C/C=N/OS(=O)(=O)c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(OC)c2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28N2O14S4/c1-21-5-9-23(10-6-21)47(33,34)43-27-15-13-25(19-29(27)41-3)49(37,38)45-31-17-18-32-46-50(39,40)26-14-16-28(30(20-26)42-4)44-48(35,36)24-11-7-22(2)8-12-24/h5-20H,1-4H3/b31-17+,32-18+ |
| InChIKey | ZWGDKRNSLVHWRA-LTTYKRRRSA-N |
| XLogP | 3.94 |
| TPSA | 216.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|