C25H25NO7S — CID 26414606
[4-[(E)-3-(2,5-dimethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 26414606) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is [4-[(E)-3-(2,5-dimethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-3-(2,5-dimethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 26414606 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [4-[(E)-3-(2,5-dimethoxyanilino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(OC)c(NC(=O)/C=C/c2ccc(OS(=O)(=O)c3ccc(C)cc3)c(OC)c2)c1 |
| InChI | InChI=1S/C25H25NO7S/c1-17-5-10-20(11-6-17)34(28,29)33-23-12-7-18(15-24(23)32-4)8-14-25(27)26-21-16-19(30-2)9-13-22(21)31-3/h5-16H,1-4H3,(H,26,27)/b14-8+ |
| InChIKey | KKJJWEAOSXQSQJ-RIYZIHGNSA-N |
| XLogP | 4.44 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|