C17H16N2O5S — CID 59064224
[(Z)-[cyano-(3,4-dimethoxyphenyl)methylidene]amino] 4-methylbenzenesulfonate (PubChem CID 59064224) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is [(Z)-[cyano-(3,4-dimethoxyphenyl)methylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[cyano-(3,4-dimethoxyphenyl)methylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59064224 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [(Z)-[cyano-(3,4-dimethoxyphenyl)methylidene]amino] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C(C#N)=N/OS(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H16N2O5S/c1-12-4-7-14(8-5-12)25(20,21)24-19-15(11-18)13-6-9-16(22-2)17(10-13)23-3/h4-10H,1-3H3/b19-15+ |
| InChIKey | AAPJYHQKARGEHV-XDJHFCHBSA-N |
| XLogP | 2.65 |
| TPSA | 97.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|