C25H32N2O4S — CID 123370507
[[cyano-(4-methoxyphenyl)methylidene]amino] 4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonate (PubChem CID 123370507) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is [[cyano-(4-methoxyphenyl)methylidene]amino] 4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonate.
| Compound Name | [[cyano-(4-methoxyphenyl)methylidene]amino] 4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonate |
|---|---|
| PubChem CID | 123370507 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [[cyano-(4-methoxyphenyl)methylidene]amino] 4-(2,2,5,5-tetramethylhexan-3-yl)benzenesulfonate |
| SMILES | COc1ccc(C(C#N)=NOS(=O)(=O)c2ccc(C(CC(C)(C)C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O4S/c1-24(2,3)16-22(25(4,5)6)18-10-14-21(15-11-18)32(28,29)31-27-23(17-26)19-8-12-20(30-7)13-9-19/h8-15,22H,16H2,1-7H3 |
| InChIKey | AXQLIBNIGJPTMQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|