C12H14N2O4S — CID 87733661
[(E)-[cyano-(4-methoxyphenyl)methylidene]amino] propane-1-sulfonate (PubChem CID 87733661) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] propane-1-sulfonate.
| Compound Name | [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 87733661 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [(E)-[cyano-(4-methoxyphenyl)methylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(/C#N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-3-8-19(15,16)18-14-12(9-13)10-4-6-11(17-2)7-5-10/h4-7H,3,8H2,1-2H3/b14-12- |
| InChIKey | PMOXZPQVTVRLRF-OWBHPGMISA-N |
| XLogP | 1.68 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|