C14H14N4O4S — CID 89317544
[[cyano-[3-(C-cyano-N-hydroxycarbonimidoyl)phenyl]methylidene]amino] butane-1-sulfonate (PubChem CID 89317544) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is [[cyano-[3-(C-cyano-N-hydroxycarbonimidoyl)phenyl]methylidene]amino] butane-1-sulfonate.
| Compound Name | [[cyano-[3-(C-cyano-N-hydroxycarbonimidoyl)phenyl]methylidene]amino] butane-1-sulfonate |
|---|---|
| PubChem CID | 89317544 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [[cyano-[3-(C-cyano-N-hydroxycarbonimidoyl)phenyl]methylidene]amino] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)ON=C(C#N)c1cccc(C(C#N)=NO)c1 |
| InChI | InChI=1S/C14H14N4O4S/c1-2-3-7-23(20,21)22-18-14(10-16)12-6-4-5-11(8-12)13(9-15)17-19/h4-6,8,19H,2-3,7H2,1H3 |
| InChIKey | LOTZZUQSPQRWQR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|