About ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile
ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile (PubChem CID 20842988) has the molecular formula C11H16N3O4P
and a molecular weight of 285.24 g/mol. Its IUPAC name is ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile.
Molecular Properties
| Compound Name | ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile |
| PubChem CID | 20842988 |
| Molecular Formula | C11H16N3O4P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile |
| SMILES | CCOP(=O)(O)NC.N#C/C(=N/O)c1ccccc1 |
| InChI | InChI=1S/C8H6N2O.C3H10NO3P/c9-6-8(10-11)7-4-2-1-3-5-7;1-3-7-8(5,6)4-2/h1-5,11H;3H2,1-2H3,(H2,4,5,6)/b10-8-; |
| InChIKey | CAZWDPUMSAGMKC-DQMXGCRQSA-N |
| XLogP | 1.73 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile?
The IUPAC name of ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile (CID 20842988) is ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile.
What is the SMILES notation for ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile?
The canonical SMILES for ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile is CCOP(=O)(O)NC.N#C/C(=N/O)c1ccccc1.
What is the InChIKey of ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile?
The InChIKey is CAZWDPUMSAGMKC-DQMXGCRQSA-N. The full InChI is InChI=1S/C8H6N2O.C3H10NO3P/c9-6-8(10-11)7-4-2-1-3-5-7;1-3-7-8(5,6)4-2/h1-5,11H;3H2,1-2H3,(H2,4,5,6)/b10-8-;.
What are the key properties of ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile?
ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile has a molecular weight of 285.24 g/mol, XLogP of 1.73, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy-N-methylphosphonamidic acid;(2E)-2-hydroxyimino-2-phenylacetonitrile is sourced from PubChem (CID 20842988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).