C12H14N2O3S — CID 87424810
[[cyano(phenyl)methylidene]amino] butane-1-sulfonate (PubChem CID 87424810) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is [[cyano(phenyl)methylidene]amino] butane-1-sulfonate.
| Compound Name | [[cyano(phenyl)methylidene]amino] butane-1-sulfonate |
|---|---|
| PubChem CID | 87424810 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [[cyano(phenyl)methylidene]amino] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)ON=C(C#N)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O3S/c1-2-3-9-18(15,16)17-14-12(10-13)11-7-5-4-6-8-11/h4-8H,2-3,9H2,1H3 |
| InChIKey | WQPJDEVRPFZZCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|