C34H34N4O4S — CID 162012532
[(2-hydroxyimino-1,2-diphenylethylidene)amino] butane-1-sulfonate;bis(1H-indole) (PubChem CID 162012532) has the molecular formula C34H34N4O4S and a molecular weight of 594.74 g/mol. Its IUPAC name is [(2-hydroxyimino-1,2-diphenylethylidene)amino] butane-1-sulfonate;bis(1H-indole).
| Compound Name | [(2-hydroxyimino-1,2-diphenylethylidene)amino] butane-1-sulfonate;bis(1H-indole) |
|---|---|
| PubChem CID | 162012532 |
| Molecular Formula | C34H34N4O4S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [(2-hydroxyimino-1,2-diphenylethylidene)amino] butane-1-sulfonate;bis(1H-indole) |
| SMILES | CCCCS(=O)(=O)ON=C(C(=NO)c1ccccc1)c1ccccc1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H20N2O4S.2C8H7N/c1-2-3-14-25(22,23)24-20-18(16-12-8-5-9-13-16)17(19-21)15-10-6-4-7-11-15;2*1-2-4-8-7(3-1)5-6-9-8/h4-13,21H,2-3,14H2,1H3;2*1-6,9H |
| InChIKey | YTQXQDSSCGXYHA-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|