About 1-chloropentane;1H-indole
1-chloropentane;1H-indole (PubChem CID 174343786) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is 1-chloropentane;1H-indole.
Molecular Properties
| Compound Name | 1-chloropentane;1H-indole |
| PubChem CID | 174343786 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-chloropentane;1H-indole |
| SMILES | CCCCCCl.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C5H11Cl/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4-5-6/h1-6,9H;2-5H2,1H3 |
| InChIKey | FHOJTVWHLNNERK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;1H-indole?
The IUPAC name of 1-chloropentane;1H-indole (CID 174343786) is 1-chloropentane;1H-indole.
What is the SMILES notation for 1-chloropentane;1H-indole?
The canonical SMILES for 1-chloropentane;1H-indole is CCCCCCl.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1-chloropentane;1H-indole?
The InChIKey is FHOJTVWHLNNERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C5H11Cl/c1-2-4-8-7(3-1)5-6-9-8;1-2-3-4-5-6/h1-6,9H;2-5H2,1H3.
What are the key properties of 1-chloropentane;1H-indole?
1-chloropentane;1H-indole has a molecular weight of 223.75 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;1H-indole is sourced from PubChem (CID 174343786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).